2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								/* This Source Code Form is subject to the terms of the Mozilla Public
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 * License, v. 2.0. If a copy of the MPL was not distributed with this
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								 * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const {EventEmitter} = ChromeUtils.import('resource://gre/modules/EventEmitter.jsm');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const {Helper} = ChromeUtils.import('chrome://juggler/content/Helper.js');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const {SimpleChannel} = ChromeUtils.import('chrome://juggler/content/SimpleChannel.js');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const {Services} = ChromeUtils.import("resource://gre/modules/Services.jsm");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const {Preferences} = ChromeUtils.import("resource://gre/modules/Preferences.jsm");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const {ContextualIdentityService} = ChromeUtils.import("resource://gre/modules/ContextualIdentityService.jsm");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const {NetUtil} = ChromeUtils.import('resource://gre/modules/NetUtil.jsm');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const {AppConstants} = ChromeUtils.import("resource://gre/modules/AppConstants.jsm");
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								const {OS} = ChromeUtils.import("resource://gre/modules/osfile.jsm");
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								const Cr = Components.results;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const helper = new Helper();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const IDENTITY_NAME = 'JUGGLER ';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const HUNDRED_YEARS = 60 * 60 * 24 * 365 * 100;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								const ALL_PERMISSIONS = [
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  'geo',
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  'desktop-notification',
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								class DownloadInterceptor {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  constructor(registry) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry = registry
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._handlerToUuid = new Map();
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._uuidToHandler = new Map();
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  //
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  // nsIDownloadInterceptor implementation.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  //
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  interceptDownloadRequest(externalAppHandler, request, browsingContext, outFile) {
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 00:15:24 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (!(request instanceof Ci.nsIChannel))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const channel = request.QueryInterface(Ci.nsIChannel);
							 | 
						
					
						
							
								
									
										
										
										
											2021-11-01 17:37:07 +01:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    let pageTarget = this._registry._browserBrowsingContextToTarget.get(channel.loadInfo.browsingContext.top);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!pageTarget)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const browserContext = pageTarget.browserContext();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const options = browserContext.downloadOptions;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!options)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const uuid = helper.generateId();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    let file = null;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (options.behavior === 'saveToDisk') {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      file = Cc["@mozilla.org/file/local;1"].createInstance(Ci.nsIFile);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      file.initWithPath(options.downloadsDir);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      file.append(uuid);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      try {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        file.create(Ci.nsIFile.NORMAL_FILE_TYPE, 0o600);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      } catch (e) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        dump(`interceptDownloadRequest failed to create file: ${e}\n`);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    outFile.value = file;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._handlerToUuid.set(externalAppHandler, uuid);
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._uuidToHandler.set(uuid, externalAppHandler);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const downloadInfo = {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      uuid,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      browserContextId: browserContext.browserContextId,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      pageTargetId: pageTarget.id(),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      url: request.name,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      suggestedFileName: externalAppHandler.suggestedFileName,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry.emit(TargetRegistry.Events.DownloadCreated, downloadInfo);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  onDownloadComplete(externalAppHandler, canceled, errorName) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const uuid = this._handlerToUuid.get(externalAppHandler);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!uuid)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._handlerToUuid.delete(externalAppHandler);
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._uuidToHandler.delete(uuid);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const downloadInfo = {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      uuid,
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      error: errorName,
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (canceled === 'NS_BINDING_ABORTED') {
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      downloadInfo.canceled = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry.emit(TargetRegistry.Events.DownloadFinished, downloadInfo);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async cancelDownload(uuid) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const externalAppHandler = this._uuidToHandler.get(uuid);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!externalAppHandler) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await externalAppHandler.cancel(Cr.NS_BINDING_ABORTED);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								const screencastService = Cc['@mozilla.org/juggler/screencast;1'].getService(Ci.nsIScreencastService);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								class TargetRegistry {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  constructor() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    EventEmitter.decorate(this);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._browserContextIdToBrowserContext = new Map();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._userContextIdToBrowserContext = new Map();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._browserToTarget = new Map();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._browserBrowsingContextToTarget = new Map();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-07 15:38:06 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._browserProxy = null;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Cleanup containers from previous runs (if any)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const identity of ContextualIdentityService.getPublicIdentities()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (identity.name && identity.name.startsWith(IDENTITY_NAME)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ContextualIdentityService.remove(identity.userContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        ContextualIdentityService.closeContainerTabs(identity.userContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._defaultContext = new BrowserContext(this, undefined, undefined);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Services.obs.addObserver({
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      observe: (subject, topic, data) => {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const browser = subject.ownerElement;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!browser)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const target = this._browserToTarget.get(browser);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!target)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          return;
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        target.emit(PageTarget.Events.Crashed);
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-25 14:50:40 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        target.dispose();
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }, 'oop-frameloader-crashed');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Services.mm.addMessageListener('juggler:content-ready', {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      receiveMessage: message => {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        const linkedBrowser = message.target;
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        const target = this._browserToTarget.get(linkedBrowser);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!target)
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return {
							 | 
						
					
						
							
								
									
										
										
										
											2022-02-14 20:32:12 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								          initScripts: target.browserContext().initScripts,
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								          bindings: target.browserContext().bindings,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          settings: target.browserContext().settings,
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      },
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 00:36:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const onTabOpenListener = (appWindow, window, event) => {
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const tab = event.target;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const userContextId = tab.userContextId;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const browserContext = this._userContextIdToBrowserContext.get(userContextId);
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 04:13:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      const hasExplicitSize = appWindow && (appWindow.chromeFlags & Ci.nsIWebBrowserChrome.JUGGLER_WINDOW_EXPLICIT_SIZE) !== 0;
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      const openerContext = tab.linkedBrowser.browsingContext.opener;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      let openerTarget;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (openerContext) {
							 | 
						
					
						
							
								
									
										
										
										
											2021-10-28 02:16:37 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        // Popups usually have opener context. Get top context for the case when opener is
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // an iframe.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        openerTarget = this._browserBrowsingContextToTarget.get(openerContext.top);
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      } else if (tab.openerTab) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // Noopener popups from the same window have opener tab instead.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        openerTarget = this._browserToTarget.get(tab.openerTab.linkedBrowser);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (!browserContext)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        throw new Error(`Internal error: cannot find context for userContextId=${userContextId}`);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const target = new PageTarget(this, window, tab, browserContext, openerTarget);
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 08:02:22 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      target.updateUserAgent();
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-25 11:45:45 -04:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      target.updatePlatform();
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-11 03:37:57 +03:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      target.updateJavaScriptDisabled();
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-18 08:19:09 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      target.updateTouchOverride();
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      target.updateColorSchemeOverride();
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-18 21:23:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      target.updateReducedMotionOverride();
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-08 16:00:15 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      target.updateForcedColorsOverride();
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      if (!hasExplicitSize)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        target.updateViewportSize();
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      if (browserContext.videoRecordingOptions)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        target._startVideoRecording(browserContext.videoRecordingOptions);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-19 12:52:43 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const onTabCloseListener = event => {
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const tab = event.target;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const linkedBrowser = tab.linkedBrowser;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const target = this._browserToTarget.get(linkedBrowser);
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-20 13:26:04 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      if (target)
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-25 14:50:40 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								          target.dispose();
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 00:36:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const domWindowTabListeners = new Map();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const onOpenWindow = async (appWindow) => {
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 04:13:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      let domWindow;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (appWindow instanceof Ci.nsIAppWindow) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        domWindow = appWindow.QueryInterface(Ci.nsIInterfaceRequestor).getInterface(Ci.nsIDOMWindowInternal || Ci.nsIDOMWindow);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        domWindow = appWindow;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        appWindow = null;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 00:36:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      if (!(domWindow instanceof Ci.nsIDOMChromeWindow))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      // In persistent mode, window might be opened long ago and might be
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      // already initialized.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      //
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      // In this case, we want to keep this callback synchronous so that we will call
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      // `onTabOpenListener` synchronously and before the sync IPc message `juggler:content-ready`.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (domWindow.document.readyState === 'uninitialized' || domWindow.document.readyState === 'loading') {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // For non-initialized windows, DOMContentLoaded initializes gBrowser
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // and starts tab loading (see //browser/base/content/browser.js), so we
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // are guaranteed to call `onTabOpenListener` before the sync IPC message
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        // `juggler:content-ready`.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        await helper.awaitEvent(domWindow, 'DOMContentLoaded');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 00:36:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (!domWindow.gBrowser)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const tabContainer = domWindow.gBrowser.tabContainer;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      domWindowTabListeners.set(domWindow, [
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        helper.addEventListener(tabContainer, 'TabOpen', event => onTabOpenListener(appWindow, domWindow, event)),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        helper.addEventListener(tabContainer, 'TabClose', onTabCloseListener),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      ]);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      for (const tab of domWindow.gBrowser.tabs)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        onTabOpenListener(appWindow, domWindow, { target: tab });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const onCloseWindow = window => {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const domWindow = window.QueryInterface(Ci.nsIInterfaceRequestor).getInterface(Ci.nsIDOMWindowInternal || Ci.nsIDOMWindow);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (!(domWindow instanceof Ci.nsIDOMChromeWindow))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (!domWindow.gBrowser)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const listeners = domWindowTabListeners.get(domWindow) || [];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      domWindowTabListeners.delete(domWindow);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      helper.removeListeners(listeners);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      for (const tab of domWindow.gBrowser.tabs)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        onTabCloseListener({ target: tab });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const extHelperAppSvc = Cc["@mozilla.org/uriloader/external-helper-app-service;1"].getService(Ci.nsIExternalHelperAppService);
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._downloadInterceptor = new DownloadInterceptor(this);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    extHelperAppSvc.setDownloadInterceptor(this._downloadInterceptor);
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 00:36:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    Services.wm.addListener({ onOpenWindow, onCloseWindow });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const win of Services.wm.getEnumerator(null))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      onOpenWindow(win);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-30 01:29:58 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async cancelDownload(options) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._downloadInterceptor.cancelDownload(options.uuid);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-07 15:38:06 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setBrowserProxy(proxy) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._browserProxy = proxy;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  getProxyInfo(channel) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const originAttributes = channel.loadInfo && channel.loadInfo.originAttributes;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const browserContext = originAttributes ? this.browserContextForUserContextId(originAttributes.userContextId) : null;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Prefer context proxy and fallback to browser-level proxy.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const proxyInfo = (browserContext && browserContext._proxy) || this._browserProxy;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!proxyInfo || proxyInfo.bypass.some(domainSuffix => channel.URI.host.endsWith(domainSuffix)))
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return null;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return proxyInfo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  defaultContext() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._defaultContext;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  createBrowserContext(removeOnDetach) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return new BrowserContext(this, helper.generateId(), removeOnDetach);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  browserContextForId(browserContextId) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._browserContextIdToBrowserContext.get(browserContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-04 08:52:43 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  browserContextForUserContextId(userContextId) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._userContextIdToBrowserContext.get(userContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async newPage({browserContextId}) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const browserContext = this.browserContextForId(browserContextId);
							 | 
						
					
						
							
								
									
										
										
										
											2020-07-02 14:46:57 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const features = "chrome,dialog=no,all";
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // See _callWithURIToLoad in browser.js for the structure of window.arguments
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // window.arguments[1]: unused (bug 871161)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [2]: referrerInfo (nsIReferrerInfo)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [3]: postData (nsIInputStream)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [4]: allowThirdPartyFixup (bool)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [5]: userContextId (int)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [6]: originPrincipal (nsIPrincipal)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [7]: originStoragePrincipal (nsIPrincipal)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [8]: triggeringPrincipal (nsIPrincipal)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [9]: allowInheritPrincipal (bool)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [10]: csp (nsIContentSecurityPolicy)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //                 [11]: nsOpenWindowInfo
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const args = Cc["@mozilla.org/array;1"].createInstance(Ci.nsIMutableArray);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const urlSupports = Cc["@mozilla.org/supports-string;1"].createInstance(
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      Ci.nsISupportsString
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    );
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    urlSupports.data = 'about:blank';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(urlSupports); // 0
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(undefined); // 1
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(undefined); // 2
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(undefined); // 3
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(undefined); // 4
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const userContextIdSupports = Cc[
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      "@mozilla.org/supports-PRUint32;1"
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    ].createInstance(Ci.nsISupportsPRUint32);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    userContextIdSupports.data = browserContext.userContextId;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(userContextIdSupports); // 5
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(undefined); // 6
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(undefined); // 7
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    args.appendElement(Services.scriptSecurityManager.getSystemPrincipal()); // 8
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const window = Services.ww.openWindow(null, AppConstants.BROWSER_CHROME_URL, '_blank', features, args);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await waitForWindowReady(window);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (window.gBrowser.browsers.length !== 1)
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 00:36:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      throw new Error(`Unexpected number of tabs in the new window: ${window.gBrowser.browsers.length}`);
							 | 
						
					
						
							
								
									
										
										
										
											2020-07-02 14:46:57 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const browser = window.gBrowser.browsers[0];
							 | 
						
					
						
							
								
									
										
										
										
											2022-06-30 11:07:38 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    let target = this._browserToTarget.get(browser);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    while (!target) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      await helper.awaitEvent(this, TargetRegistry.Events.TargetCreated);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      target = this._browserToTarget.get(browser);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2020-07-02 14:46:57 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    browser.focus();
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (browserContext.settings.timezoneId) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (await target.hasFailedToOverrideTimezone())
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        throw new Error('Failed to override timezone');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return target.id();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 04:13:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  targets() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return Array.from(this._browserToTarget.values());
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  targetForBrowser(browser) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._browserToTarget.get(browser);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								class PageTarget {
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  constructor(registry, win, tab, browserContext, opener) {
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    EventEmitter.decorate(this);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._targetId = helper.generateId();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry = registry;
							 | 
						
					
						
							
								
									
										
										
										
											2020-07-07 14:04:07 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._window = win;
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._gBrowser = win.gBrowser;
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._tab = tab;
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser = tab.linkedBrowser;
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._browserContext = browserContext;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._viewportSize = undefined;
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._initialDPPX = this._linkedBrowser.browsingContext.overrideDPPX;
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._url = 'about:blank';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._openerId = opener ? opener.id() : undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._channel = SimpleChannel.createForMessageManager(`browser::page[${this._targetId}]`, this._linkedBrowser.messageManager);
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._videoRecordingInfo = undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._screencastRecordingInfo = undefined;
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._dialogs = new Map();
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-08 16:00:15 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.forcedColors = 'no-override';
							 | 
						
					
						
							
								
									
										
										
										
											2022-02-14 20:32:12 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._pageInitScripts = [];
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const navigationListener = {
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-06 10:32:50 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      QueryInterface: ChromeUtils.generateQI([Ci.nsIWebProgressListener, Ci.nsISupportsWeakReference]),
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      onLocationChange: (aWebProgress, aRequest, aLocation) => this._onNavigated(aLocation),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._eventListeners = [
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-28 14:47:14 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      helper.addObserver(this._updateModalDialogs.bind(this), 'tabmodal-dialog-loaded'),
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      helper.addProgressListener(tab.linkedBrowser, navigationListener, Ci.nsIWebProgress.NOTIFY_LOCATION),
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      helper.addEventListener(this._linkedBrowser, 'DOMModalDialogClosed', event => this._updateModalDialogs()),
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    ];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._disposed = false;
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-19 15:39:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    browserContext.pages.add(this);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry._browserToTarget.set(this._linkedBrowser, this);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry._browserBrowsingContextToTarget.set(this._linkedBrowser.browsingContext, this);
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-10 14:37:48 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 04:13:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._registry.emit(TargetRegistry.Events.TargetCreated, this);
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  dialog(dialogId) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._dialogs.get(dialogId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  dialogs() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return [...this._dialogs.values()];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-10 14:37:48 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async windowReady() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await waitForWindowReady(this._window);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  linkedBrowser() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._linkedBrowser;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  browserContext() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._browserContext;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-18 08:19:09 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  updateTouchOverride() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.touchEventsOverride = this._browserContext.touchOverride ? 'enabled' : 'none';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 08:02:22 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  updateUserAgent() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.customUserAgent = this._browserContext.defaultUserAgent;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-25 11:45:45 -04:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  updatePlatform() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.customPlatform = this._browserContext.defaultPlatform;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-11 03:37:57 +03:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  updateJavaScriptDisabled() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.allowJavascript = !this._browserContext.javaScriptDisabled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  _updateModalDialogs() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const prompts = new Set(this._linkedBrowser.tabModalPromptBox ? this._linkedBrowser.tabModalPromptBox.listPrompts() : []);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const dialog of this._dialogs.values()) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (!prompts.has(dialog.prompt())) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        this._dialogs.delete(dialog.id());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        this.emit(PageTarget.Events.DialogClosed, dialog);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        prompts.delete(dialog.prompt());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const prompt of prompts) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const dialog = Dialog.createIfSupported(prompt);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (!dialog)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      this._dialogs.set(dialog.id(), dialog);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      this.emit(PageTarget.Events.DialogOpened, dialog);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async updateViewportSize() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Viewport size is defined by three arguments:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // 1. default size. Could be explicit if set as part of `window.open` call, e.g.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //   `window.open(url, title, 'width=400,height=400')`
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // 2. page viewport size
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // 3. browserContext viewport size
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    //
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // The "default size" (1) is only respected when the page is opened.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Otherwise, explicitly set page viewport prevales over browser context
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // default viewport.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const viewportSize = this._viewportSize || this._browserContext.defaultViewportSize;
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 04:13:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const actualSize = await setViewportSizeForBrowser(viewportSize, this._linkedBrowser, this._window);
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.overrideDPPX = this._browserContext.deviceScaleFactor || this._initialDPPX;
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this._channel.connect('').send('awaitViewportDimensions', {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      width: actualSize.width,
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      height: actualSize.height,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      deviceSizeIsPageSize: !!this._browserContext.deviceScaleFactor,
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setEmulatedMedia(mediumOverride) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.mediumOverride = mediumOverride || '';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  setColorScheme(colorScheme) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.colorScheme = fromProtocolColorScheme(colorScheme);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.updateColorSchemeOverride();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  updateColorSchemeOverride() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.prefersColorSchemeOverride = this.colorScheme || this._browserContext.colorScheme || 'none';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-18 21:23:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setReducedMotion(reducedMotion) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.reducedMotion = fromProtocolReducedMotion(reducedMotion);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.updateReducedMotionOverride();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  updateReducedMotionOverride() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.prefersReducedMotionOverride = this.reducedMotion || this._browserContext.reducedMotion || 'none';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-08 16:00:15 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setForcedColors(forcedColors) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.forcedColors = fromProtocolForcedColors(forcedColors);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.updateForcedColorsOverride();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  updateForcedColorsOverride() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._linkedBrowser.browsingContext.forcedColorsOverride = (this.forcedColors !== 'no-override' ? this.forcedColors : this._browserContext.forcedColors) || 'no-override';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 02:10:34 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async setViewportSize(viewportSize) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._viewportSize = viewportSize;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this.updateViewportSize();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-02 17:29:54 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  close(runBeforeUnload = false) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._gBrowser.removeTab(this._tab, {
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      skipPermitUnload: !runBeforeUnload,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 04:13:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  channel() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._channel;
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  id() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._targetId;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  info() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      targetId: this.id(),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      type: 'page',
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-19 15:39:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      browserContextId: this._browserContext.browserContextId,
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      openerId: this._openerId,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  _onNavigated(aLocation) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._url = aLocation.spec;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._browserContext.grantPermissionsToOrigin(this._url);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async ensurePermissions() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this._channel.connect('').send('ensurePermissions', {}).catch(e => void e);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2022-02-14 20:32:12 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async setInitScripts(scripts) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._pageInitScripts = scripts;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this.pushInitScripts();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async pushInitScripts() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this._channel.connect('').send('setInitScripts', [...this._browserContext.initScripts, ...this._pageInitScripts]).catch(e => void e);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-11 16:27:39 +00:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async addBinding(worldName, name, script) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this._channel.connect('').send('addBinding', { worldName, name, script }).catch(e => void e);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async applyContextSetting(name, value) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this._channel.connect('').send('applyContextSetting', { name, value }).catch(e => void e);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async hasFailedToOverrideTimezone() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return await this._channel.connect('').send('hasFailedToOverrideTimezone').catch(e => true);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-05 13:27:51 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async _startVideoRecording({width, height, dir}) {
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // On Mac the window may not yet be visible when TargetCreated and its
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // NSWindow.windowNumber may be -1, so we wait until the window is known
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // to be initialized and visible.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this.windowReady();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const file = OS.Path.join(dir, helper.generateId() + '.webm');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (width < 10 || width > 10000 || height < 10 || height > 10000)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      throw new Error("Invalid size");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const docShell = this._gBrowser.ownerGlobal.docShell;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Exclude address bar and navigation control from the video.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const rect = this.linkedBrowser().getBoundingClientRect();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const devicePixelRatio = this._window.devicePixelRatio;
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    let sessionId;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const registry = this._registry;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const screencastClient = {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      QueryInterface: ChromeUtils.generateQI([Ci.nsIScreencastServiceClient]),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      screencastFrame(data, deviceWidth, deviceHeight) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      },
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      screencastStopped() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        registry.emit(TargetRegistry.Events.ScreencastStopped, sessionId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      },
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-10 22:01:41 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const viewport = this._viewportSize || this._browserContext.defaultViewportSize || { width: 0, height: 0 };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    sessionId = screencastService.startVideoRecording(screencastClient, docShell, true, file, width, height, 0, viewport.width, viewport.height, devicePixelRatio * rect.top);
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._videoRecordingInfo = { sessionId, file };
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.emit(PageTarget.Events.ScreencastStarted);
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  _stopVideoRecording() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!this._videoRecordingInfo)
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      throw new Error('No video recording in progress');
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const videoRecordingInfo = this._videoRecordingInfo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._videoRecordingInfo = undefined;
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    screencastService.stopVideoRecording(videoRecordingInfo.sessionId);
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  videoRecordingInfo() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._videoRecordingInfo;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async startScreencast({ width, height, quality }) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // On Mac the window may not yet be visible when TargetCreated and its
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // NSWindow.windowNumber may be -1, so we wait until the window is known
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // to be initialized and visible.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await this.windowReady();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (width < 10 || width > 10000 || height < 10 || height > 10000)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      throw new Error("Invalid size");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const docShell = this._gBrowser.ownerGlobal.docShell;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Exclude address bar and navigation control from the video.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const rect = this.linkedBrowser().getBoundingClientRect();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const devicePixelRatio = this._window.devicePixelRatio;
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const self = this;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const screencastClient = {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      QueryInterface: ChromeUtils.generateQI([Ci.nsIScreencastServiceClient]),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      screencastFrame(data, deviceWidth, deviceHeight) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (self._screencastRecordingInfo)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          self.emit(PageTarget.Events.ScreencastFrame, { data, deviceWidth, deviceHeight });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      },
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      screencastStopped() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      },
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-10 22:01:41 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const viewport = this._viewportSize || this._browserContext.defaultViewportSize || { width: 0, height: 0 };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const screencastId = screencastService.startVideoRecording(screencastClient, docShell, false, '', width, height, quality || 90, viewport.width, viewport.height, devicePixelRatio * rect.top);
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._screencastRecordingInfo = { screencastId };
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return { screencastId };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  screencastFrameAck({ screencastId }) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!this._screencastRecordingInfo || this._screencastRecordingInfo.screencastId !== screencastId)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return;
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    screencastService.screencastFrameAck(screencastId);
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  stopScreencast() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!this._screencastRecordingInfo)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      throw new Error('No screencast in progress');
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const { screencastId } = this._screencastRecordingInfo;
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._screencastRecordingInfo = undefined;
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    screencastService.stopVideoRecording(screencastId);
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-25 14:50:40 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  dispose() {
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._disposed = true;
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    if (this._videoRecordingInfo)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      this._stopVideoRecording();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (this._screencastRecordingInfo)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      this.stopScreencast();
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-25 14:50:40 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._browserContext.pages.delete(this);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry._browserToTarget.delete(this._linkedBrowser);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry._browserBrowsingContextToTarget.delete(this._linkedBrowser.browsingContext);
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-20 10:48:06 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    try {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      helper.removeListeners(this._eventListeners);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } catch (e) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      // In some cases, removing listeners from this._linkedBrowser fails
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      // because it is already half-destroyed.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (e)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        dump(e.message + '\n' + e.stack + '\n');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 04:13:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._registry.emit(TargetRegistry.Events.TargetDestroyed, this);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								PageTarget.Events = {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  ScreencastStarted: Symbol('PageTarget.ScreencastStarted'),
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  ScreencastFrame: Symbol('PageTarget.ScreencastFrame'),
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  Crashed: Symbol('PageTarget.Crashed'),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  DialogOpened: Symbol('PageTarget.DialogOpened'),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  DialogClosed: Symbol('PageTarget.DialogClosed'),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								function fromProtocolColorScheme(colorScheme) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  if (colorScheme === 'light' || colorScheme === 'dark')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return colorScheme;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  if (colorScheme === null || colorScheme === 'no-preference')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  throw new Error('Unknown color scheme: ' + colorScheme);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-18 21:23:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								function fromProtocolReducedMotion(reducedMotion) {
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-20 21:07:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  if (reducedMotion === 'reduce' || reducedMotion === 'no-preference')
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-18 21:23:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return reducedMotion;
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-20 21:07:39 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  if (reducedMotion === null)
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-18 21:23:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    return undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  throw new Error('Unknown reduced motion: ' + reducedMotion);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-08 16:00:15 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								function fromProtocolForcedColors(forcedColors) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  if (forcedColors === 'active' || forcedColors === 'none')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return forcedColors;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  if (forcedColors === null)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  throw new Error('Unknown forced colors: ' + forcedColors);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								class BrowserContext {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  constructor(registry, browserContextId, removeOnDetach) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry = registry;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.browserContextId = browserContextId;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Default context has userContextId === 0, but we pass undefined to many APIs just in case.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.userContextId = 0;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (browserContextId !== undefined) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const identity = ContextualIdentityService.create(IDENTITY_NAME + browserContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      this.userContextId = identity.userContextId;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._principals = [];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    // Maps origins to the permission lists.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._permissions = new Map();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry._browserContextIdToBrowserContext.set(this.browserContextId, this);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry._userContextIdToBrowserContext.set(this.userContextId, this);
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-07 15:38:06 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._proxy = null;
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.removeOnDetach = removeOnDetach;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.extraHTTPHeaders = undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.httpCredentials = undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.requestInterceptionEnabled = undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.ignoreHTTPSErrors = undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.downloadOptions = undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.defaultViewportSize = undefined;
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.deviceScaleFactor = undefined;
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 08:02:22 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.defaultUserAgent = null;
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-25 11:45:45 -04:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.defaultPlatform = null;
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-11 03:37:57 +03:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.javaScriptDisabled = false;
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-18 08:19:09 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.touchOverride = false;
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.colorScheme = 'none';
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-08 16:00:15 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.forcedColors = 'no-override';
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-18 21:23:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.reducedMotion = 'none';
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.videoRecordingOptions = undefined;
							 | 
						
					
						
							
								
									
										
										
										
											2022-02-14 20:32:12 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.initScripts = [];
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.bindings = [];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.settings = {};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.pages = new Set();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setColorScheme(colorScheme) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.colorScheme = fromProtocolColorScheme(colorScheme);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      page.updateColorSchemeOverride();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-18 21:23:12 +02:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setReducedMotion(reducedMotion) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.reducedMotion = fromProtocolReducedMotion(reducedMotion);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      page.updateReducedMotionOverride();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-06-08 16:00:15 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setForcedColors(forcedColors) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.forcedColors = fromProtocolForcedColors(forcedColors);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      page.updateForcedColorsOverride();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async destroy() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (this.userContextId !== 0) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      ContextualIdentityService.remove(this.userContextId);
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-02 17:29:54 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      for (const page of this.pages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        page.close();
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (this.pages.size) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        await new Promise(f => {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          const listener = helper.on(this._registry, TargetRegistry.Events.TargetDestroyed, () => {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            if (!this.pages.size) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								              helper.removeListeners([listener]);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								              f();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								            }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry._browserContextIdToBrowserContext.delete(this.browserContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._registry._userContextIdToBrowserContext.delete(this.userContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-07 15:38:06 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setProxy(proxy) {
							 | 
						
					
						
							
								
									
										
										
										
											2020-12-21 15:54:15 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    // Clear AuthCache.
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Services.obs.notifyObservers(null, "net:clear-active-logins");
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-07 15:38:06 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this._proxy = proxy;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  setIgnoreHTTPSErrors(ignoreHTTPSErrors) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (this.ignoreHTTPSErrors === ignoreHTTPSErrors)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.ignoreHTTPSErrors = ignoreHTTPSErrors;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const certOverrideService = Cc[
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      "@mozilla.org/security/certoverride;1"
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    ].getService(Ci.nsICertOverrideService);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (ignoreHTTPSErrors) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      Preferences.set("network.stricttransportsecurity.preloadlist", false);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      Preferences.set("security.cert_pinning.enforcement_level", 0);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      certOverrideService.setDisableAllSecurityChecksAndLetAttackersInterceptMyData(true, this.userContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      certOverrideService.setDisableAllSecurityChecksAndLetAttackersInterceptMyData(false, this.userContextId);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-11 03:37:57 +03:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setDefaultUserAgent(userAgent) {
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 08:02:22 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.defaultUserAgent = userAgent;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      page.updateUserAgent();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-25 11:45:45 -04:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setDefaultPlatform(platform) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.defaultPlatform = platform;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      page.updatePlatform();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-11 03:37:57 +03:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setJavaScriptDisabled(javaScriptDisabled) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.javaScriptDisabled = javaScriptDisabled;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      page.updateJavaScriptDisabled();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-18 08:19:09 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  setTouchOverride(touchOverride) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.touchOverride = touchOverride;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      page.updateTouchOverride();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async setDefaultViewport(viewport) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.defaultViewportSize = viewport ? viewport.viewportSize : undefined;
							 | 
						
					
						
							
								
									
										
										
										
											2021-03-02 18:52:19 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    this.deviceScaleFactor = viewport ? viewport.deviceScaleFactor : undefined;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await Promise.all(Array.from(this.pages).map(page => page.updateViewportSize()));
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2022-02-14 20:32:12 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async setInitScripts(scripts) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.initScripts = scripts;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await Promise.all(Array.from(this.pages).map(page => page.pushInitScripts()));
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-11 16:27:39 +00:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async addBinding(worldName, name, script) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.bindings.push({ worldName, name, script });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await Promise.all(Array.from(this.pages).map(page => page.addBinding(worldName, name, script)));
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async applySetting(name, value) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.settings[name] = value;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await Promise.all(Array.from(this.pages).map(page => page.applyContextSetting(name, value)));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  async grantPermissions(origin, permissions) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._permissions.set(origin, permissions);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const promises = [];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (origin === '*' || page._url.startsWith(origin)) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        this.grantPermissionsToOrigin(page._url);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        promises.push(page.ensurePermissions());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await Promise.all(promises);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  resetPermissions() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const principal of this._principals) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      for (const permission of ALL_PERMISSIONS)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        Services.perms.removeFromPrincipal(principal, permission);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._principals = [];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._permissions.clear();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  grantPermissionsToOrigin(url) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    let origin = Array.from(this._permissions.keys()).find(key => url.startsWith(key));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!origin)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      origin = '*';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const permissions = this._permissions.get(origin);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (!permissions)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      return;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const attrs = { userContextId: this.userContextId || undefined };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const principal = Services.scriptSecurityManager.createContentPrincipal(NetUtil.newURI(url), attrs);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._principals.push(principal);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const permission of ALL_PERMISSIONS) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const action = permissions.includes(permission) ? Ci.nsIPermissionManager.ALLOW_ACTION : Ci.nsIPermissionManager.DENY_ACTION;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      Services.perms.addFromPrincipal(principal, permission, action, Ci.nsIPermissionManager.EXPIRE_NEVER, 0 /* expireTime */);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  setCookies(cookies) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const protocolToSameSite = {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      [undefined]: Ci.nsICookie.SAMESITE_NONE,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      'Lax': Ci.nsICookie.SAMESITE_LAX,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      'Strict': Ci.nsICookie.SAMESITE_STRICT,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (const cookie of cookies) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      const uri = cookie.url ? NetUtil.newURI(cookie.url) : null;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      let domain = cookie.domain;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (!domain) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (!uri)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          throw new Error('At least one of the url and domain needs to be specified');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        domain = uri.host;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      let path = cookie.path;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (!path)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        path = uri ? dirPath(uri.filePath) : '/';
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      let secure = false;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (cookie.secure !== undefined)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        secure = cookie.secure;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      else if (uri && uri.scheme === 'https')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        secure = true;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      Services.cookies.add(
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        domain,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        path,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        cookie.name,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        cookie.value,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        secure,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        cookie.httpOnly || false,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        cookie.expires === undefined || cookie.expires === -1 /* isSession */,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        cookie.expires === undefined ? Date.now() + HUNDRED_YEARS : cookie.expires,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        { userContextId: this.userContextId || undefined } /* originAttributes */,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        protocolToSameSite[cookie.sameSite],
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-06 10:32:50 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        Ci.nsICookie.SCHEME_UNSET
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      );
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  clearCookies() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    Services.cookies.removeCookiesWithOriginAttributes(JSON.stringify({ userContextId: this.userContextId || undefined }));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  getCookies() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const result = [];
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const sameSiteToProtocol = {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      [Ci.nsICookie.SAMESITE_NONE]: 'None',
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      [Ci.nsICookie.SAMESITE_LAX]: 'Lax',
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      [Ci.nsICookie.SAMESITE_STRICT]: 'Strict',
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    for (let cookie of Services.cookies.cookies) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (cookie.originAttributes.userContextId !== this.userContextId)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (cookie.host === 'addons.mozilla.org')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        continue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      result.push({
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        name: cookie.name,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        value: cookie.value,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        domain: cookie.host,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        path: cookie.path,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        expires: cookie.isSession ? -1 : cookie.expiry,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        size: cookie.name.length + cookie.value.length,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        httpOnly: cookie.isHttpOnly,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        secure: cookie.isSecure,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        session: cookie.isSession,
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        sameSite: sameSiteToProtocol[cookie.sameSite],
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      });
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return result;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-19 12:43:53 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-06 19:11:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  async setVideoRecordingOptions(options) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this.videoRecordingOptions = options;
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const promises = [];
							 | 
						
					
						
							
								
									
										
										
										
											2021-08-12 17:17:54 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    for (const page of this.pages) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      if (options)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        promises.push(page._startVideoRecording(options));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      else if (page._videoRecordingInfo)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        promises.push(page._stopVideoRecording());
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 17:16:49 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    await Promise.all(promises);
							 | 
						
					
						
							
								
									
										
										
										
											2020-08-19 12:43:53 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								class Dialog {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  static createIfSupported(prompt) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const type = prompt.args.promptType;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    switch (type) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      case 'alert':
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-30 20:05:15 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      case 'alertCheck':
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return new Dialog(prompt, 'alert');
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      case 'prompt':
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-30 20:05:15 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								        return new Dialog(prompt, 'prompt');
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      case 'confirm':
							 | 
						
					
						
							
								
									
										
										
										
											2020-11-30 20:05:15 -08:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      case 'confirmCheck':
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return new Dialog(prompt, 'confirm');
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								      case 'confirmEx':
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return new Dialog(prompt, 'beforeunload');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      default:
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        return null;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  constructor(prompt, type) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._id = helper.generateId();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._type = type;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._prompt = prompt;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  id() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._id;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  message() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._prompt.ui.infoBody.textContent;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  type() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._type;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  prompt() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._prompt;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  dismiss() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (this._prompt.ui.button1)
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      this._prompt.ui.button1.click();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    else
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      this._prompt.ui.button0.click();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  defaultValue() {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    return this._prompt.ui.loginTextbox.value;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  accept(promptValue) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    if (typeof promptValue === 'string' && this._type === 'prompt')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      this._prompt.ui.loginTextbox.value = promptValue;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    this._prompt.ui.button0.click();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								function dirPath(path) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  return path.substring(0, path.lastIndexOf('/') + 1);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-09 22:48:10 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								async function waitForWindowReady(window) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  if (window.delayedStartupPromise) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await window.delayedStartupPromise;
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await new Promise((resolve => {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      Services.obs.addObserver(function observer(aSubject, aTopic) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        if (window == aSubject) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          Services.obs.removeObserver(observer, aTopic);
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								          resolve();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								        }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								      }, "browser-delayed-startup-finished");
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    }));
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							
								
									
										
										
										
											2020-09-30 00:36:46 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  if (window.document.readyState !== 'complete')
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    await helper.awaitEvent(window, 'load');
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-09 22:48:10 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-02 04:13:42 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								async function setViewportSizeForBrowser(viewportSize, browser, window) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  await waitForWindowReady(window);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  if (viewportSize) {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    const {width, height} = viewportSize;
							 | 
						
					
						
							
								
									
										
										
										
											2020-07-07 14:04:07 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								    const rect = browser.getBoundingClientRect();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    window.resizeBy(width - rect.width, height - rect.height);
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    browser.style.setProperty('min-width', width + 'px');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    browser.style.setProperty('min-height', height + 'px');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    browser.style.setProperty('max-width', width + 'px');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    browser.style.setProperty('max-height', height + 'px');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  } else {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    browser.style.removeProperty('min-width');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    browser.style.removeProperty('min-height');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    browser.style.removeProperty('max-width');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								    browser.style.removeProperty('max-height');
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  }
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  const rect = browser.getBoundingClientRect();
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  return { width: rect.width, height: rect.height };
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								}
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								TargetRegistry.Events = {
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  TargetCreated: Symbol('TargetRegistry.Events.TargetCreated'),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  TargetDestroyed: Symbol('TargetRegistry.Events.TargetDestroyed'),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  DownloadCreated: Symbol('TargetRegistry.Events.DownloadCreated'),
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								  DownloadFinished: Symbol('TargetRegistry.Events.DownloadFinished'),
							 | 
						
					
						
							
								
									
										
										
										
											2021-05-07 18:05:26 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								  ScreencastStopped: Symbol('TargetRegistry.ScreencastStopped'),
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								};
							 | 
						
					
						
							| 
								
							 | 
							
								
							 | 
							
								
							 | 
							
							
								
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								var EXPORTED_SYMBOLS = ['TargetRegistry', 'PageTarget'];
							 | 
						
					
						
							
								
									
										
										
										
											2020-06-02 16:51:13 -07:00
										 
									 
								 
							 | 
							
								
							 | 
							
								
							 | 
							
							
								this.TargetRegistry = TargetRegistry;
							 | 
						
					
						
							
								
									
										
										
										
											2020-10-06 01:53:25 -07:00
										 
									 
								 
							 | 
							
								
									
										
									
								
							 | 
							
								
							 | 
							
							
								this.PageTarget = PageTarget;
							 |