mirror of
				https://github.com/microsoft/playwright.git
				synced 2025-06-26 21:40:17 +00:00 
			
		
		
		
	 458c9b2207
			
		
	
	
		458c9b2207
		
			
		
	
	
	
	
		
			
			It looks like the tabopen callback is async, so we must make sure it is called when opening new pages.
		
			
				
	
	
		
			1066 lines
		
	
	
		
			37 KiB
		
	
	
	
		
			JavaScript
		
	
	
	
	
	
			
		
		
	
	
			1066 lines
		
	
	
		
			37 KiB
		
	
	
	
		
			JavaScript
		
	
	
	
	
	
| /* This Source Code Form is subject to the terms of the Mozilla Public
 | |
|  * License, v. 2.0. If a copy of the MPL was not distributed with this
 | |
|  * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
 | |
| 
 | |
| const {EventEmitter} = ChromeUtils.import('resource://gre/modules/EventEmitter.jsm');
 | |
| const {Helper} = ChromeUtils.import('chrome://juggler/content/Helper.js');
 | |
| const {SimpleChannel} = ChromeUtils.import('chrome://juggler/content/SimpleChannel.js');
 | |
| const {Services} = ChromeUtils.import("resource://gre/modules/Services.jsm");
 | |
| const {Preferences} = ChromeUtils.import("resource://gre/modules/Preferences.jsm");
 | |
| const {ContextualIdentityService} = ChromeUtils.import("resource://gre/modules/ContextualIdentityService.jsm");
 | |
| const {NetUtil} = ChromeUtils.import('resource://gre/modules/NetUtil.jsm');
 | |
| const {AppConstants} = ChromeUtils.import("resource://gre/modules/AppConstants.jsm");
 | |
| const {OS} = ChromeUtils.import("resource://gre/modules/osfile.jsm");
 | |
| 
 | |
| const Cr = Components.results;
 | |
| 
 | |
| const helper = new Helper();
 | |
| 
 | |
| const IDENTITY_NAME = 'JUGGLER ';
 | |
| const HUNDRED_YEARS = 60 * 60 * 24 * 365 * 100;
 | |
| 
 | |
| const ALL_PERMISSIONS = [
 | |
|   'geo',
 | |
|   'desktop-notification',
 | |
| ];
 | |
| 
 | |
| class DownloadInterceptor {
 | |
|   constructor(registry) {
 | |
|     this._registry = registry
 | |
|     this._handlerToUuid = new Map();
 | |
|     this._uuidToHandler = new Map();
 | |
|   }
 | |
| 
 | |
|   //
 | |
|   // nsIDownloadInterceptor implementation.
 | |
|   //
 | |
|   interceptDownloadRequest(externalAppHandler, request, browsingContext, outFile) {
 | |
|     if (!(request instanceof Ci.nsIChannel))
 | |
|       return false;
 | |
|     const channel = request.QueryInterface(Ci.nsIChannel);
 | |
|     let pageTarget = this._registry._browserBrowsingContextToTarget.get(channel.loadInfo.browsingContext.top);
 | |
|     if (!pageTarget)
 | |
|       return false;
 | |
| 
 | |
|     const browserContext = pageTarget.browserContext();
 | |
|     const options = browserContext.downloadOptions;
 | |
|     if (!options)
 | |
|       return false;
 | |
| 
 | |
|     const uuid = helper.generateId();
 | |
|     let file = null;
 | |
|     if (options.behavior === 'saveToDisk') {
 | |
|       file = Cc["@mozilla.org/file/local;1"].createInstance(Ci.nsIFile);
 | |
|       file.initWithPath(options.downloadsDir);
 | |
|       file.append(uuid);
 | |
| 
 | |
|       try {
 | |
|         file.create(Ci.nsIFile.NORMAL_FILE_TYPE, 0o600);
 | |
|       } catch (e) {
 | |
|         dump(`interceptDownloadRequest failed to create file: ${e}\n`);
 | |
|         return false;
 | |
|       }
 | |
|     }
 | |
|     outFile.value = file;
 | |
|     this._handlerToUuid.set(externalAppHandler, uuid);
 | |
|     this._uuidToHandler.set(uuid, externalAppHandler);
 | |
|     const downloadInfo = {
 | |
|       uuid,
 | |
|       browserContextId: browserContext.browserContextId,
 | |
|       pageTargetId: pageTarget.id(),
 | |
|       url: request.name,
 | |
|       suggestedFileName: externalAppHandler.suggestedFileName,
 | |
|     };
 | |
|     this._registry.emit(TargetRegistry.Events.DownloadCreated, downloadInfo);
 | |
|     return true;
 | |
|   }
 | |
| 
 | |
|   onDownloadComplete(externalAppHandler, canceled, errorName) {
 | |
|     const uuid = this._handlerToUuid.get(externalAppHandler);
 | |
|     if (!uuid)
 | |
|       return;
 | |
|     this._handlerToUuid.delete(externalAppHandler);
 | |
|     this._uuidToHandler.delete(uuid);
 | |
|     const downloadInfo = {
 | |
|       uuid,
 | |
|       error: errorName,
 | |
|     };
 | |
|     if (canceled === 'NS_BINDING_ABORTED') {
 | |
|       downloadInfo.canceled = true;
 | |
|     }
 | |
|     this._registry.emit(TargetRegistry.Events.DownloadFinished, downloadInfo);
 | |
|   }
 | |
| 
 | |
|   async cancelDownload(uuid) {
 | |
|     const externalAppHandler = this._uuidToHandler.get(uuid);
 | |
|     if (!externalAppHandler) {
 | |
|       return;
 | |
|     }
 | |
|     await externalAppHandler.cancel(Cr.NS_BINDING_ABORTED);
 | |
|   }
 | |
| }
 | |
| 
 | |
| const screencastService = Cc['@mozilla.org/juggler/screencast;1'].getService(Ci.nsIScreencastService);
 | |
| 
 | |
| class TargetRegistry {
 | |
|   constructor() {
 | |
|     EventEmitter.decorate(this);
 | |
| 
 | |
|     this._browserContextIdToBrowserContext = new Map();
 | |
|     this._userContextIdToBrowserContext = new Map();
 | |
|     this._browserToTarget = new Map();
 | |
|     this._browserBrowsingContextToTarget = new Map();
 | |
| 
 | |
|     this._browserProxy = null;
 | |
| 
 | |
|     // Cleanup containers from previous runs (if any)
 | |
|     for (const identity of ContextualIdentityService.getPublicIdentities()) {
 | |
|       if (identity.name && identity.name.startsWith(IDENTITY_NAME)) {
 | |
|         ContextualIdentityService.remove(identity.userContextId);
 | |
|         ContextualIdentityService.closeContainerTabs(identity.userContextId);
 | |
|       }
 | |
|     }
 | |
| 
 | |
|     this._defaultContext = new BrowserContext(this, undefined, undefined);
 | |
| 
 | |
|     Services.obs.addObserver({
 | |
|       observe: (subject, topic, data) => {
 | |
|         const browser = subject.ownerElement;
 | |
|         if (!browser)
 | |
|           return;
 | |
|         const target = this._browserToTarget.get(browser);
 | |
|         if (!target)
 | |
|           return;
 | |
|         target.emit(PageTarget.Events.Crashed);
 | |
|         target.dispose();
 | |
|       }
 | |
|     }, 'oop-frameloader-crashed');
 | |
| 
 | |
|     Services.mm.addMessageListener('juggler:content-ready', {
 | |
|       receiveMessage: message => {
 | |
|         const linkedBrowser = message.target;
 | |
|         const target = this._browserToTarget.get(linkedBrowser);
 | |
|         if (!target)
 | |
|           return;
 | |
| 
 | |
|         return {
 | |
|           initScripts: target.browserContext().initScripts,
 | |
|           bindings: target.browserContext().bindings,
 | |
|           settings: target.browserContext().settings,
 | |
|         };
 | |
|       },
 | |
|     });
 | |
| 
 | |
|     const onTabOpenListener = (appWindow, window, event) => {
 | |
|       const tab = event.target;
 | |
|       const userContextId = tab.userContextId;
 | |
|       const browserContext = this._userContextIdToBrowserContext.get(userContextId);
 | |
|       const hasExplicitSize = appWindow && (appWindow.chromeFlags & Ci.nsIWebBrowserChrome.JUGGLER_WINDOW_EXPLICIT_SIZE) !== 0;
 | |
|       const openerContext = tab.linkedBrowser.browsingContext.opener;
 | |
|       let openerTarget;
 | |
|       if (openerContext) {
 | |
|         // Popups usually have opener context. Get top context for the case when opener is
 | |
|         // an iframe.
 | |
|         openerTarget = this._browserBrowsingContextToTarget.get(openerContext.top);
 | |
|       } else if (tab.openerTab) {
 | |
|         // Noopener popups from the same window have opener tab instead.
 | |
|         openerTarget = this._browserToTarget.get(tab.openerTab.linkedBrowser);
 | |
|       }
 | |
|       if (!browserContext)
 | |
|         throw new Error(`Internal error: cannot find context for userContextId=${userContextId}`);
 | |
|       const target = new PageTarget(this, window, tab, browserContext, openerTarget);
 | |
|       target.updateUserAgent();
 | |
|       target.updatePlatform();
 | |
|       target.updateJavaScriptDisabled();
 | |
|       target.updateTouchOverride();
 | |
|       target.updateColorSchemeOverride();
 | |
|       target.updateReducedMotionOverride();
 | |
|       target.updateForcedColorsOverride();
 | |
|       if (!hasExplicitSize)
 | |
|         target.updateViewportSize();
 | |
|       if (browserContext.videoRecordingOptions)
 | |
|         target._startVideoRecording(browserContext.videoRecordingOptions);
 | |
|     };
 | |
| 
 | |
|     const onTabCloseListener = event => {
 | |
|       const tab = event.target;
 | |
|       const linkedBrowser = tab.linkedBrowser;
 | |
|       const target = this._browserToTarget.get(linkedBrowser);
 | |
|       if (target)
 | |
|           target.dispose();
 | |
|     };
 | |
| 
 | |
|     const domWindowTabListeners = new Map();
 | |
| 
 | |
|     const onOpenWindow = async (appWindow) => {
 | |
| 
 | |
|       let domWindow;
 | |
|       if (appWindow instanceof Ci.nsIAppWindow) {
 | |
|         domWindow = appWindow.QueryInterface(Ci.nsIInterfaceRequestor).getInterface(Ci.nsIDOMWindowInternal || Ci.nsIDOMWindow);
 | |
|       } else {
 | |
|         domWindow = appWindow;
 | |
|         appWindow = null;
 | |
|       }
 | |
|       if (!(domWindow instanceof Ci.nsIDOMChromeWindow))
 | |
|         return;
 | |
|       // In persistent mode, window might be opened long ago and might be
 | |
|       // already initialized.
 | |
|       //
 | |
|       // In this case, we want to keep this callback synchronous so that we will call
 | |
|       // `onTabOpenListener` synchronously and before the sync IPc message `juggler:content-ready`.
 | |
|       if (domWindow.document.readyState === 'uninitialized' || domWindow.document.readyState === 'loading') {
 | |
|         // For non-initialized windows, DOMContentLoaded initializes gBrowser
 | |
|         // and starts tab loading (see //browser/base/content/browser.js), so we
 | |
|         // are guaranteed to call `onTabOpenListener` before the sync IPC message
 | |
|         // `juggler:content-ready`.
 | |
|         await helper.awaitEvent(domWindow, 'DOMContentLoaded');
 | |
|       }
 | |
| 
 | |
|       if (!domWindow.gBrowser)
 | |
|         return;
 | |
|       const tabContainer = domWindow.gBrowser.tabContainer;
 | |
|       domWindowTabListeners.set(domWindow, [
 | |
|         helper.addEventListener(tabContainer, 'TabOpen', event => onTabOpenListener(appWindow, domWindow, event)),
 | |
|         helper.addEventListener(tabContainer, 'TabClose', onTabCloseListener),
 | |
|       ]);
 | |
|       for (const tab of domWindow.gBrowser.tabs)
 | |
|         onTabOpenListener(appWindow, domWindow, { target: tab });
 | |
|     };
 | |
| 
 | |
|     const onCloseWindow = window => {
 | |
|       const domWindow = window.QueryInterface(Ci.nsIInterfaceRequestor).getInterface(Ci.nsIDOMWindowInternal || Ci.nsIDOMWindow);
 | |
|       if (!(domWindow instanceof Ci.nsIDOMChromeWindow))
 | |
|         return;
 | |
|       if (!domWindow.gBrowser)
 | |
|         return;
 | |
| 
 | |
|       const listeners = domWindowTabListeners.get(domWindow) || [];
 | |
|       domWindowTabListeners.delete(domWindow);
 | |
|       helper.removeListeners(listeners);
 | |
|       for (const tab of domWindow.gBrowser.tabs)
 | |
|         onTabCloseListener({ target: tab });
 | |
|     };
 | |
| 
 | |
|     const extHelperAppSvc = Cc["@mozilla.org/uriloader/external-helper-app-service;1"].getService(Ci.nsIExternalHelperAppService);
 | |
|     this._downloadInterceptor = new DownloadInterceptor(this);
 | |
|     extHelperAppSvc.setDownloadInterceptor(this._downloadInterceptor);
 | |
| 
 | |
|     Services.wm.addListener({ onOpenWindow, onCloseWindow });
 | |
|     for (const win of Services.wm.getEnumerator(null))
 | |
|       onOpenWindow(win);
 | |
|   }
 | |
| 
 | |
|   async cancelDownload(options) {
 | |
|     this._downloadInterceptor.cancelDownload(options.uuid);
 | |
|   }
 | |
| 
 | |
|   setBrowserProxy(proxy) {
 | |
|     this._browserProxy = proxy;
 | |
|   }
 | |
| 
 | |
|   getProxyInfo(channel) {
 | |
|     const originAttributes = channel.loadInfo && channel.loadInfo.originAttributes;
 | |
|     const browserContext = originAttributes ? this.browserContextForUserContextId(originAttributes.userContextId) : null;
 | |
|     // Prefer context proxy and fallback to browser-level proxy.
 | |
|     const proxyInfo = (browserContext && browserContext._proxy) || this._browserProxy;
 | |
|     if (!proxyInfo || proxyInfo.bypass.some(domainSuffix => channel.URI.host.endsWith(domainSuffix)))
 | |
|       return null;
 | |
|     return proxyInfo;
 | |
|   }
 | |
| 
 | |
|   defaultContext() {
 | |
|     return this._defaultContext;
 | |
|   }
 | |
| 
 | |
|   createBrowserContext(removeOnDetach) {
 | |
|     return new BrowserContext(this, helper.generateId(), removeOnDetach);
 | |
|   }
 | |
| 
 | |
|   browserContextForId(browserContextId) {
 | |
|     return this._browserContextIdToBrowserContext.get(browserContextId);
 | |
|   }
 | |
| 
 | |
|   browserContextForUserContextId(userContextId) {
 | |
|     return this._userContextIdToBrowserContext.get(userContextId);
 | |
|   }
 | |
| 
 | |
|   async newPage({browserContextId}) {
 | |
|     const browserContext = this.browserContextForId(browserContextId);
 | |
|     const features = "chrome,dialog=no,all";
 | |
|     // See _callWithURIToLoad in browser.js for the structure of window.arguments
 | |
|     // window.arguments[1]: unused (bug 871161)
 | |
|     //                 [2]: referrerInfo (nsIReferrerInfo)
 | |
|     //                 [3]: postData (nsIInputStream)
 | |
|     //                 [4]: allowThirdPartyFixup (bool)
 | |
|     //                 [5]: userContextId (int)
 | |
|     //                 [6]: originPrincipal (nsIPrincipal)
 | |
|     //                 [7]: originStoragePrincipal (nsIPrincipal)
 | |
|     //                 [8]: triggeringPrincipal (nsIPrincipal)
 | |
|     //                 [9]: allowInheritPrincipal (bool)
 | |
|     //                 [10]: csp (nsIContentSecurityPolicy)
 | |
|     //                 [11]: nsOpenWindowInfo
 | |
|     const args = Cc["@mozilla.org/array;1"].createInstance(Ci.nsIMutableArray);
 | |
|     const urlSupports = Cc["@mozilla.org/supports-string;1"].createInstance(
 | |
|       Ci.nsISupportsString
 | |
|     );
 | |
|     urlSupports.data = 'about:blank';
 | |
|     args.appendElement(urlSupports); // 0
 | |
|     args.appendElement(undefined); // 1
 | |
|     args.appendElement(undefined); // 2
 | |
|     args.appendElement(undefined); // 3
 | |
|     args.appendElement(undefined); // 4
 | |
|     const userContextIdSupports = Cc[
 | |
|       "@mozilla.org/supports-PRUint32;1"
 | |
|     ].createInstance(Ci.nsISupportsPRUint32);
 | |
|     userContextIdSupports.data = browserContext.userContextId;
 | |
|     args.appendElement(userContextIdSupports); // 5
 | |
|     args.appendElement(undefined); // 6
 | |
|     args.appendElement(undefined); // 7
 | |
|     args.appendElement(Services.scriptSecurityManager.getSystemPrincipal()); // 8
 | |
| 
 | |
|     const window = Services.ww.openWindow(null, AppConstants.BROWSER_CHROME_URL, '_blank', features, args);
 | |
|     await waitForWindowReady(window);
 | |
|     if (window.gBrowser.browsers.length !== 1)
 | |
|       throw new Error(`Unexpected number of tabs in the new window: ${window.gBrowser.browsers.length}`);
 | |
|     const browser = window.gBrowser.browsers[0];
 | |
|     let target = this._browserToTarget.get(browser);
 | |
|     while (!target) {
 | |
|       await helper.awaitEvent(this, TargetRegistry.Events.TargetCreated);
 | |
|       target = this._browserToTarget.get(browser);
 | |
|     }
 | |
|     browser.focus();
 | |
|     if (browserContext.settings.timezoneId) {
 | |
|       if (await target.hasFailedToOverrideTimezone())
 | |
|         throw new Error('Failed to override timezone');
 | |
|     }
 | |
|     return target.id();
 | |
|   }
 | |
| 
 | |
|   targets() {
 | |
|     return Array.from(this._browserToTarget.values());
 | |
|   }
 | |
| 
 | |
|   targetForBrowser(browser) {
 | |
|     return this._browserToTarget.get(browser);
 | |
|   }
 | |
| }
 | |
| 
 | |
| class PageTarget {
 | |
|   constructor(registry, win, tab, browserContext, opener) {
 | |
|     EventEmitter.decorate(this);
 | |
| 
 | |
|     this._targetId = helper.generateId();
 | |
|     this._registry = registry;
 | |
|     this._window = win;
 | |
|     this._gBrowser = win.gBrowser;
 | |
|     this._tab = tab;
 | |
|     this._linkedBrowser = tab.linkedBrowser;
 | |
|     this._browserContext = browserContext;
 | |
|     this._viewportSize = undefined;
 | |
|     this._initialDPPX = this._linkedBrowser.browsingContext.overrideDPPX;
 | |
|     this._url = 'about:blank';
 | |
|     this._openerId = opener ? opener.id() : undefined;
 | |
|     this._channel = SimpleChannel.createForMessageManager(`browser::page[${this._targetId}]`, this._linkedBrowser.messageManager);
 | |
|     this._videoRecordingInfo = undefined;
 | |
|     this._screencastRecordingInfo = undefined;
 | |
|     this._dialogs = new Map();
 | |
|     this.forcedColors = 'no-override';
 | |
|     this._pageInitScripts = [];
 | |
| 
 | |
|     const navigationListener = {
 | |
|       QueryInterface: ChromeUtils.generateQI([Ci.nsIWebProgressListener, Ci.nsISupportsWeakReference]),
 | |
|       onLocationChange: (aWebProgress, aRequest, aLocation) => this._onNavigated(aLocation),
 | |
|     };
 | |
|     this._eventListeners = [
 | |
|       helper.addObserver(this._updateModalDialogs.bind(this), 'tabmodal-dialog-loaded'),
 | |
|       helper.addProgressListener(tab.linkedBrowser, navigationListener, Ci.nsIWebProgress.NOTIFY_LOCATION),
 | |
|       helper.addEventListener(this._linkedBrowser, 'DOMModalDialogClosed', event => this._updateModalDialogs()),
 | |
|     ];
 | |
| 
 | |
|     this._disposed = false;
 | |
|     browserContext.pages.add(this);
 | |
|     this._registry._browserToTarget.set(this._linkedBrowser, this);
 | |
|     this._registry._browserBrowsingContextToTarget.set(this._linkedBrowser.browsingContext, this);
 | |
| 
 | |
|     this._registry.emit(TargetRegistry.Events.TargetCreated, this);
 | |
|   }
 | |
| 
 | |
|   dialog(dialogId) {
 | |
|     return this._dialogs.get(dialogId);
 | |
|   }
 | |
| 
 | |
|   dialogs() {
 | |
|     return [...this._dialogs.values()];
 | |
|   }
 | |
| 
 | |
|   async windowReady() {
 | |
|     await waitForWindowReady(this._window);
 | |
|   }
 | |
| 
 | |
|   linkedBrowser() {
 | |
|     return this._linkedBrowser;
 | |
|   }
 | |
| 
 | |
|   browserContext() {
 | |
|     return this._browserContext;
 | |
|   }
 | |
| 
 | |
|   updateTouchOverride() {
 | |
|     this._linkedBrowser.browsingContext.touchEventsOverride = this._browserContext.touchOverride ? 'enabled' : 'none';
 | |
|   }
 | |
| 
 | |
|   updateUserAgent() {
 | |
|     this._linkedBrowser.browsingContext.customUserAgent = this._browserContext.defaultUserAgent;
 | |
|   }
 | |
| 
 | |
|   updatePlatform() {
 | |
|     this._linkedBrowser.browsingContext.customPlatform = this._browserContext.defaultPlatform;
 | |
|   }
 | |
| 
 | |
|   updateJavaScriptDisabled() {
 | |
|     this._linkedBrowser.browsingContext.allowJavascript = !this._browserContext.javaScriptDisabled;
 | |
|   }
 | |
| 
 | |
|   _updateModalDialogs() {
 | |
|     const prompts = new Set(this._linkedBrowser.tabModalPromptBox ? this._linkedBrowser.tabModalPromptBox.listPrompts() : []);
 | |
|     for (const dialog of this._dialogs.values()) {
 | |
|       if (!prompts.has(dialog.prompt())) {
 | |
|         this._dialogs.delete(dialog.id());
 | |
|         this.emit(PageTarget.Events.DialogClosed, dialog);
 | |
|       } else {
 | |
|         prompts.delete(dialog.prompt());
 | |
|       }
 | |
|     }
 | |
|     for (const prompt of prompts) {
 | |
|       const dialog = Dialog.createIfSupported(prompt);
 | |
|       if (!dialog)
 | |
|         continue;
 | |
|       this._dialogs.set(dialog.id(), dialog);
 | |
|       this.emit(PageTarget.Events.DialogOpened, dialog);
 | |
|     }
 | |
|   }
 | |
| 
 | |
|   async updateViewportSize() {
 | |
|     // Viewport size is defined by three arguments:
 | |
|     // 1. default size. Could be explicit if set as part of `window.open` call, e.g.
 | |
|     //   `window.open(url, title, 'width=400,height=400')`
 | |
|     // 2. page viewport size
 | |
|     // 3. browserContext viewport size
 | |
|     //
 | |
|     // The "default size" (1) is only respected when the page is opened.
 | |
|     // Otherwise, explicitly set page viewport prevales over browser context
 | |
|     // default viewport.
 | |
|     const viewportSize = this._viewportSize || this._browserContext.defaultViewportSize;
 | |
|     const actualSize = await setViewportSizeForBrowser(viewportSize, this._linkedBrowser, this._window);
 | |
|     this._linkedBrowser.browsingContext.overrideDPPX = this._browserContext.deviceScaleFactor || this._initialDPPX;
 | |
|     await this._channel.connect('').send('awaitViewportDimensions', {
 | |
|       width: actualSize.width,
 | |
|       height: actualSize.height,
 | |
|       deviceSizeIsPageSize: !!this._browserContext.deviceScaleFactor,
 | |
|     });
 | |
|   }
 | |
| 
 | |
|   setEmulatedMedia(mediumOverride) {
 | |
|     this._linkedBrowser.browsingContext.mediumOverride = mediumOverride || '';
 | |
|   }
 | |
| 
 | |
|   setColorScheme(colorScheme) {
 | |
|     this.colorScheme = fromProtocolColorScheme(colorScheme);
 | |
|     this.updateColorSchemeOverride();
 | |
|   }
 | |
| 
 | |
|   updateColorSchemeOverride() {
 | |
|     this._linkedBrowser.browsingContext.prefersColorSchemeOverride = this.colorScheme || this._browserContext.colorScheme || 'none';
 | |
|   }
 | |
| 
 | |
|   setReducedMotion(reducedMotion) {
 | |
|     this.reducedMotion = fromProtocolReducedMotion(reducedMotion);
 | |
|     this.updateReducedMotionOverride();
 | |
|   }
 | |
| 
 | |
|   updateReducedMotionOverride() {
 | |
|     this._linkedBrowser.browsingContext.prefersReducedMotionOverride = this.reducedMotion || this._browserContext.reducedMotion || 'none';
 | |
|   }
 | |
| 
 | |
|   setForcedColors(forcedColors) {
 | |
|     this.forcedColors = fromProtocolForcedColors(forcedColors);
 | |
|     this.updateForcedColorsOverride();
 | |
|   }
 | |
| 
 | |
|   updateForcedColorsOverride() {
 | |
|     this._linkedBrowser.browsingContext.forcedColorsOverride = (this.forcedColors !== 'no-override' ? this.forcedColors : this._browserContext.forcedColors) || 'no-override';
 | |
|   }
 | |
| 
 | |
|   async setViewportSize(viewportSize) {
 | |
|     this._viewportSize = viewportSize;
 | |
|     await this.updateViewportSize();
 | |
|   }
 | |
| 
 | |
|   close(runBeforeUnload = false) {
 | |
|     this._gBrowser.removeTab(this._tab, {
 | |
|       skipPermitUnload: !runBeforeUnload,
 | |
|     });
 | |
|   }
 | |
| 
 | |
|   channel() {
 | |
|     return this._channel;
 | |
|   }
 | |
| 
 | |
|   id() {
 | |
|     return this._targetId;
 | |
|   }
 | |
| 
 | |
|   info() {
 | |
|     return {
 | |
|       targetId: this.id(),
 | |
|       type: 'page',
 | |
|       browserContextId: this._browserContext.browserContextId,
 | |
|       openerId: this._openerId,
 | |
|     };
 | |
|   }
 | |
| 
 | |
|   _onNavigated(aLocation) {
 | |
|     this._url = aLocation.spec;
 | |
|     this._browserContext.grantPermissionsToOrigin(this._url);
 | |
|   }
 | |
| 
 | |
|   async ensurePermissions() {
 | |
|     await this._channel.connect('').send('ensurePermissions', {}).catch(e => void e);
 | |
|   }
 | |
| 
 | |
|   async setInitScripts(scripts) {
 | |
|     this._pageInitScripts = scripts;
 | |
|     await this.pushInitScripts();
 | |
|   }
 | |
| 
 | |
|   async pushInitScripts() {
 | |
|     await this._channel.connect('').send('setInitScripts', [...this._browserContext.initScripts, ...this._pageInitScripts]).catch(e => void e);
 | |
|   }
 | |
| 
 | |
|   async addBinding(worldName, name, script) {
 | |
|     await this._channel.connect('').send('addBinding', { worldName, name, script }).catch(e => void e);
 | |
|   }
 | |
| 
 | |
|   async applyContextSetting(name, value) {
 | |
|     await this._channel.connect('').send('applyContextSetting', { name, value }).catch(e => void e);
 | |
|   }
 | |
| 
 | |
|   async hasFailedToOverrideTimezone() {
 | |
|     return await this._channel.connect('').send('hasFailedToOverrideTimezone').catch(e => true);
 | |
|   }
 | |
| 
 | |
|   async _startVideoRecording({width, height, dir}) {
 | |
|     // On Mac the window may not yet be visible when TargetCreated and its
 | |
|     // NSWindow.windowNumber may be -1, so we wait until the window is known
 | |
|     // to be initialized and visible.
 | |
|     await this.windowReady();
 | |
|     const file = OS.Path.join(dir, helper.generateId() + '.webm');
 | |
|     if (width < 10 || width > 10000 || height < 10 || height > 10000)
 | |
|       throw new Error("Invalid size");
 | |
| 
 | |
|     const docShell = this._gBrowser.ownerGlobal.docShell;
 | |
|     // Exclude address bar and navigation control from the video.
 | |
|     const rect = this.linkedBrowser().getBoundingClientRect();
 | |
|     const devicePixelRatio = this._window.devicePixelRatio;
 | |
|     let sessionId;
 | |
|     const registry = this._registry;
 | |
|     const screencastClient = {
 | |
|       QueryInterface: ChromeUtils.generateQI([Ci.nsIScreencastServiceClient]),
 | |
|       screencastFrame(data, deviceWidth, deviceHeight) {
 | |
|       },
 | |
|       screencastStopped() {
 | |
|         registry.emit(TargetRegistry.Events.ScreencastStopped, sessionId);
 | |
|       },
 | |
|     };
 | |
|     const viewport = this._viewportSize || this._browserContext.defaultViewportSize || { width: 0, height: 0 };
 | |
|     sessionId = screencastService.startVideoRecording(screencastClient, docShell, true, file, width, height, 0, viewport.width, viewport.height, devicePixelRatio * rect.top);
 | |
|     this._videoRecordingInfo = { sessionId, file };
 | |
|     this.emit(PageTarget.Events.ScreencastStarted);
 | |
|   }
 | |
| 
 | |
|   _stopVideoRecording() {
 | |
|     if (!this._videoRecordingInfo)
 | |
|       throw new Error('No video recording in progress');
 | |
|     const videoRecordingInfo = this._videoRecordingInfo;
 | |
|     this._videoRecordingInfo = undefined;
 | |
|     screencastService.stopVideoRecording(videoRecordingInfo.sessionId);
 | |
|   }
 | |
| 
 | |
|   videoRecordingInfo() {
 | |
|     return this._videoRecordingInfo;
 | |
|   }
 | |
| 
 | |
|   async startScreencast({ width, height, quality }) {
 | |
|     // On Mac the window may not yet be visible when TargetCreated and its
 | |
|     // NSWindow.windowNumber may be -1, so we wait until the window is known
 | |
|     // to be initialized and visible.
 | |
|     await this.windowReady();
 | |
|     if (width < 10 || width > 10000 || height < 10 || height > 10000)
 | |
|       throw new Error("Invalid size");
 | |
| 
 | |
|     const docShell = this._gBrowser.ownerGlobal.docShell;
 | |
|     // Exclude address bar and navigation control from the video.
 | |
|     const rect = this.linkedBrowser().getBoundingClientRect();
 | |
|     const devicePixelRatio = this._window.devicePixelRatio;
 | |
| 
 | |
|     const self = this;
 | |
|     const screencastClient = {
 | |
|       QueryInterface: ChromeUtils.generateQI([Ci.nsIScreencastServiceClient]),
 | |
|       screencastFrame(data, deviceWidth, deviceHeight) {
 | |
|         if (self._screencastRecordingInfo)
 | |
|           self.emit(PageTarget.Events.ScreencastFrame, { data, deviceWidth, deviceHeight });
 | |
|       },
 | |
|       screencastStopped() {
 | |
|       },
 | |
|     };
 | |
|     const viewport = this._viewportSize || this._browserContext.defaultViewportSize || { width: 0, height: 0 };
 | |
|     const screencastId = screencastService.startVideoRecording(screencastClient, docShell, false, '', width, height, quality || 90, viewport.width, viewport.height, devicePixelRatio * rect.top);
 | |
|     this._screencastRecordingInfo = { screencastId };
 | |
|     return { screencastId };
 | |
|   }
 | |
| 
 | |
|   screencastFrameAck({ screencastId }) {
 | |
|     if (!this._screencastRecordingInfo || this._screencastRecordingInfo.screencastId !== screencastId)
 | |
|       return;
 | |
|     screencastService.screencastFrameAck(screencastId);
 | |
|   }
 | |
| 
 | |
|   stopScreencast() {
 | |
|     if (!this._screencastRecordingInfo)
 | |
|       throw new Error('No screencast in progress');
 | |
|     const { screencastId } = this._screencastRecordingInfo;
 | |
|     this._screencastRecordingInfo = undefined;
 | |
|     screencastService.stopVideoRecording(screencastId);
 | |
|   }
 | |
| 
 | |
|   dispose() {
 | |
|     this._disposed = true;
 | |
|     if (this._videoRecordingInfo)
 | |
|       this._stopVideoRecording();
 | |
|     if (this._screencastRecordingInfo)
 | |
|       this.stopScreencast();
 | |
|     this._browserContext.pages.delete(this);
 | |
|     this._registry._browserToTarget.delete(this._linkedBrowser);
 | |
|     this._registry._browserBrowsingContextToTarget.delete(this._linkedBrowser.browsingContext);
 | |
|     try {
 | |
|       helper.removeListeners(this._eventListeners);
 | |
|     } catch (e) {
 | |
|       // In some cases, removing listeners from this._linkedBrowser fails
 | |
|       // because it is already half-destroyed.
 | |
|       if (e)
 | |
|         dump(e.message + '\n' + e.stack + '\n');
 | |
|     }
 | |
|     this._registry.emit(TargetRegistry.Events.TargetDestroyed, this);
 | |
|   }
 | |
| }
 | |
| 
 | |
| PageTarget.Events = {
 | |
|   ScreencastStarted: Symbol('PageTarget.ScreencastStarted'),
 | |
|   ScreencastFrame: Symbol('PageTarget.ScreencastFrame'),
 | |
|   Crashed: Symbol('PageTarget.Crashed'),
 | |
|   DialogOpened: Symbol('PageTarget.DialogOpened'),
 | |
|   DialogClosed: Symbol('PageTarget.DialogClosed'),
 | |
| };
 | |
| 
 | |
| function fromProtocolColorScheme(colorScheme) {
 | |
|   if (colorScheme === 'light' || colorScheme === 'dark')
 | |
|     return colorScheme;
 | |
|   if (colorScheme === null || colorScheme === 'no-preference')
 | |
|     return undefined;
 | |
|   throw new Error('Unknown color scheme: ' + colorScheme);
 | |
| }
 | |
| 
 | |
| function fromProtocolReducedMotion(reducedMotion) {
 | |
|   if (reducedMotion === 'reduce' || reducedMotion === 'no-preference')
 | |
|     return reducedMotion;
 | |
|   if (reducedMotion === null)
 | |
|     return undefined;
 | |
|   throw new Error('Unknown reduced motion: ' + reducedMotion);
 | |
| }
 | |
| 
 | |
| function fromProtocolForcedColors(forcedColors) {
 | |
|   if (forcedColors === 'active' || forcedColors === 'none')
 | |
|     return forcedColors;
 | |
|   if (forcedColors === null)
 | |
|     return undefined;
 | |
|   throw new Error('Unknown forced colors: ' + forcedColors);
 | |
| }
 | |
| 
 | |
| class BrowserContext {
 | |
|   constructor(registry, browserContextId, removeOnDetach) {
 | |
|     this._registry = registry;
 | |
|     this.browserContextId = browserContextId;
 | |
|     // Default context has userContextId === 0, but we pass undefined to many APIs just in case.
 | |
|     this.userContextId = 0;
 | |
|     if (browserContextId !== undefined) {
 | |
|       const identity = ContextualIdentityService.create(IDENTITY_NAME + browserContextId);
 | |
|       this.userContextId = identity.userContextId;
 | |
|     }
 | |
|     this._principals = [];
 | |
|     // Maps origins to the permission lists.
 | |
|     this._permissions = new Map();
 | |
|     this._registry._browserContextIdToBrowserContext.set(this.browserContextId, this);
 | |
|     this._registry._userContextIdToBrowserContext.set(this.userContextId, this);
 | |
|     this._proxy = null;
 | |
|     this.removeOnDetach = removeOnDetach;
 | |
|     this.extraHTTPHeaders = undefined;
 | |
|     this.httpCredentials = undefined;
 | |
|     this.requestInterceptionEnabled = undefined;
 | |
|     this.ignoreHTTPSErrors = undefined;
 | |
|     this.downloadOptions = undefined;
 | |
|     this.defaultViewportSize = undefined;
 | |
|     this.deviceScaleFactor = undefined;
 | |
|     this.defaultUserAgent = null;
 | |
|     this.defaultPlatform = null;
 | |
|     this.javaScriptDisabled = false;
 | |
|     this.touchOverride = false;
 | |
|     this.colorScheme = 'none';
 | |
|     this.forcedColors = 'no-override';
 | |
|     this.reducedMotion = 'none';
 | |
|     this.videoRecordingOptions = undefined;
 | |
|     this.initScripts = [];
 | |
|     this.bindings = [];
 | |
|     this.settings = {};
 | |
|     this.pages = new Set();
 | |
|   }
 | |
| 
 | |
|   setColorScheme(colorScheme) {
 | |
|     this.colorScheme = fromProtocolColorScheme(colorScheme);
 | |
|     for (const page of this.pages)
 | |
|       page.updateColorSchemeOverride();
 | |
|   }
 | |
| 
 | |
|   setReducedMotion(reducedMotion) {
 | |
|     this.reducedMotion = fromProtocolReducedMotion(reducedMotion);
 | |
|     for (const page of this.pages)
 | |
|       page.updateReducedMotionOverride();
 | |
|   }
 | |
| 
 | |
|   setForcedColors(forcedColors) {
 | |
|     this.forcedColors = fromProtocolForcedColors(forcedColors);
 | |
|     for (const page of this.pages)
 | |
|       page.updateForcedColorsOverride();
 | |
|   }
 | |
| 
 | |
|   async destroy() {
 | |
|     if (this.userContextId !== 0) {
 | |
|       ContextualIdentityService.remove(this.userContextId);
 | |
|       for (const page of this.pages)
 | |
|         page.close();
 | |
|       if (this.pages.size) {
 | |
|         await new Promise(f => {
 | |
|           const listener = helper.on(this._registry, TargetRegistry.Events.TargetDestroyed, () => {
 | |
|             if (!this.pages.size) {
 | |
|               helper.removeListeners([listener]);
 | |
|               f();
 | |
|             }
 | |
|           });
 | |
|         });
 | |
|       }
 | |
|     }
 | |
|     this._registry._browserContextIdToBrowserContext.delete(this.browserContextId);
 | |
|     this._registry._userContextIdToBrowserContext.delete(this.userContextId);
 | |
|   }
 | |
| 
 | |
|   setProxy(proxy) {
 | |
|     // Clear AuthCache.
 | |
|     Services.obs.notifyObservers(null, "net:clear-active-logins");
 | |
|     this._proxy = proxy;
 | |
|   }
 | |
| 
 | |
|   setIgnoreHTTPSErrors(ignoreHTTPSErrors) {
 | |
|     if (this.ignoreHTTPSErrors === ignoreHTTPSErrors)
 | |
|       return;
 | |
|     this.ignoreHTTPSErrors = ignoreHTTPSErrors;
 | |
|     const certOverrideService = Cc[
 | |
|       "@mozilla.org/security/certoverride;1"
 | |
|     ].getService(Ci.nsICertOverrideService);
 | |
|     if (ignoreHTTPSErrors) {
 | |
|       Preferences.set("network.stricttransportsecurity.preloadlist", false);
 | |
|       Preferences.set("security.cert_pinning.enforcement_level", 0);
 | |
|       certOverrideService.setDisableAllSecurityChecksAndLetAttackersInterceptMyData(true, this.userContextId);
 | |
|     } else {
 | |
|       certOverrideService.setDisableAllSecurityChecksAndLetAttackersInterceptMyData(false, this.userContextId);
 | |
|     }
 | |
|   }
 | |
| 
 | |
|   setDefaultUserAgent(userAgent) {
 | |
|     this.defaultUserAgent = userAgent;
 | |
|     for (const page of this.pages)
 | |
|       page.updateUserAgent();
 | |
|   }
 | |
| 
 | |
|   setDefaultPlatform(platform) {
 | |
|     this.defaultPlatform = platform;
 | |
|     for (const page of this.pages)
 | |
|       page.updatePlatform();
 | |
|   }
 | |
| 
 | |
|   setJavaScriptDisabled(javaScriptDisabled) {
 | |
|     this.javaScriptDisabled = javaScriptDisabled;
 | |
|     for (const page of this.pages)
 | |
|       page.updateJavaScriptDisabled();
 | |
|   }
 | |
| 
 | |
|   setTouchOverride(touchOverride) {
 | |
|     this.touchOverride = touchOverride;
 | |
|     for (const page of this.pages)
 | |
|       page.updateTouchOverride();
 | |
|   }
 | |
| 
 | |
|   async setDefaultViewport(viewport) {
 | |
|     this.defaultViewportSize = viewport ? viewport.viewportSize : undefined;
 | |
|     this.deviceScaleFactor = viewport ? viewport.deviceScaleFactor : undefined;
 | |
|     await Promise.all(Array.from(this.pages).map(page => page.updateViewportSize()));
 | |
|   }
 | |
| 
 | |
|   async setInitScripts(scripts) {
 | |
|     this.initScripts = scripts;
 | |
|     await Promise.all(Array.from(this.pages).map(page => page.pushInitScripts()));
 | |
|   }
 | |
| 
 | |
|   async addBinding(worldName, name, script) {
 | |
|     this.bindings.push({ worldName, name, script });
 | |
|     await Promise.all(Array.from(this.pages).map(page => page.addBinding(worldName, name, script)));
 | |
|   }
 | |
| 
 | |
|   async applySetting(name, value) {
 | |
|     this.settings[name] = value;
 | |
|     await Promise.all(Array.from(this.pages).map(page => page.applyContextSetting(name, value)));
 | |
|   }
 | |
| 
 | |
|   async grantPermissions(origin, permissions) {
 | |
|     this._permissions.set(origin, permissions);
 | |
|     const promises = [];
 | |
|     for (const page of this.pages) {
 | |
|       if (origin === '*' || page._url.startsWith(origin)) {
 | |
|         this.grantPermissionsToOrigin(page._url);
 | |
|         promises.push(page.ensurePermissions());
 | |
|       }
 | |
|     }
 | |
|     await Promise.all(promises);
 | |
|   }
 | |
| 
 | |
|   resetPermissions() {
 | |
|     for (const principal of this._principals) {
 | |
|       for (const permission of ALL_PERMISSIONS)
 | |
|         Services.perms.removeFromPrincipal(principal, permission);
 | |
|     }
 | |
|     this._principals = [];
 | |
|     this._permissions.clear();
 | |
|   }
 | |
| 
 | |
|   grantPermissionsToOrigin(url) {
 | |
|     let origin = Array.from(this._permissions.keys()).find(key => url.startsWith(key));
 | |
|     if (!origin)
 | |
|       origin = '*';
 | |
| 
 | |
|     const permissions = this._permissions.get(origin);
 | |
|     if (!permissions)
 | |
|       return;
 | |
| 
 | |
|     const attrs = { userContextId: this.userContextId || undefined };
 | |
|     const principal = Services.scriptSecurityManager.createContentPrincipal(NetUtil.newURI(url), attrs);
 | |
|     this._principals.push(principal);
 | |
|     for (const permission of ALL_PERMISSIONS) {
 | |
|       const action = permissions.includes(permission) ? Ci.nsIPermissionManager.ALLOW_ACTION : Ci.nsIPermissionManager.DENY_ACTION;
 | |
|       Services.perms.addFromPrincipal(principal, permission, action, Ci.nsIPermissionManager.EXPIRE_NEVER, 0 /* expireTime */);
 | |
|     }
 | |
|   }
 | |
| 
 | |
|   setCookies(cookies) {
 | |
|     const protocolToSameSite = {
 | |
|       [undefined]: Ci.nsICookie.SAMESITE_NONE,
 | |
|       'Lax': Ci.nsICookie.SAMESITE_LAX,
 | |
|       'Strict': Ci.nsICookie.SAMESITE_STRICT,
 | |
|     };
 | |
|     for (const cookie of cookies) {
 | |
|       const uri = cookie.url ? NetUtil.newURI(cookie.url) : null;
 | |
|       let domain = cookie.domain;
 | |
|       if (!domain) {
 | |
|         if (!uri)
 | |
|           throw new Error('At least one of the url and domain needs to be specified');
 | |
|         domain = uri.host;
 | |
|       }
 | |
|       let path = cookie.path;
 | |
|       if (!path)
 | |
|         path = uri ? dirPath(uri.filePath) : '/';
 | |
|       let secure = false;
 | |
|       if (cookie.secure !== undefined)
 | |
|         secure = cookie.secure;
 | |
|       else if (uri && uri.scheme === 'https')
 | |
|         secure = true;
 | |
|       Services.cookies.add(
 | |
|         domain,
 | |
|         path,
 | |
|         cookie.name,
 | |
|         cookie.value,
 | |
|         secure,
 | |
|         cookie.httpOnly || false,
 | |
|         cookie.expires === undefined || cookie.expires === -1 /* isSession */,
 | |
|         cookie.expires === undefined ? Date.now() + HUNDRED_YEARS : cookie.expires,
 | |
|         { userContextId: this.userContextId || undefined } /* originAttributes */,
 | |
|         protocolToSameSite[cookie.sameSite],
 | |
|         Ci.nsICookie.SCHEME_UNSET
 | |
|       );
 | |
|     }
 | |
|   }
 | |
| 
 | |
|   clearCookies() {
 | |
|     Services.cookies.removeCookiesWithOriginAttributes(JSON.stringify({ userContextId: this.userContextId || undefined }));
 | |
|   }
 | |
| 
 | |
|   getCookies() {
 | |
|     const result = [];
 | |
|     const sameSiteToProtocol = {
 | |
|       [Ci.nsICookie.SAMESITE_NONE]: 'None',
 | |
|       [Ci.nsICookie.SAMESITE_LAX]: 'Lax',
 | |
|       [Ci.nsICookie.SAMESITE_STRICT]: 'Strict',
 | |
|     };
 | |
|     for (let cookie of Services.cookies.cookies) {
 | |
|       if (cookie.originAttributes.userContextId !== this.userContextId)
 | |
|         continue;
 | |
|       if (cookie.host === 'addons.mozilla.org')
 | |
|         continue;
 | |
|       result.push({
 | |
|         name: cookie.name,
 | |
|         value: cookie.value,
 | |
|         domain: cookie.host,
 | |
|         path: cookie.path,
 | |
|         expires: cookie.isSession ? -1 : cookie.expiry,
 | |
|         size: cookie.name.length + cookie.value.length,
 | |
|         httpOnly: cookie.isHttpOnly,
 | |
|         secure: cookie.isSecure,
 | |
|         session: cookie.isSession,
 | |
|         sameSite: sameSiteToProtocol[cookie.sameSite],
 | |
|       });
 | |
|     }
 | |
|     return result;
 | |
|   }
 | |
| 
 | |
|   async setVideoRecordingOptions(options) {
 | |
|     this.videoRecordingOptions = options;
 | |
|     const promises = [];
 | |
|     for (const page of this.pages) {
 | |
|       if (options)
 | |
|         promises.push(page._startVideoRecording(options));
 | |
|       else if (page._videoRecordingInfo)
 | |
|         promises.push(page._stopVideoRecording());
 | |
|     }
 | |
|     await Promise.all(promises);
 | |
|   }
 | |
| }
 | |
| 
 | |
| class Dialog {
 | |
|   static createIfSupported(prompt) {
 | |
|     const type = prompt.args.promptType;
 | |
|     switch (type) {
 | |
|       case 'alert':
 | |
|       case 'alertCheck':
 | |
|         return new Dialog(prompt, 'alert');
 | |
|       case 'prompt':
 | |
|         return new Dialog(prompt, 'prompt');
 | |
|       case 'confirm':
 | |
|       case 'confirmCheck':
 | |
|         return new Dialog(prompt, 'confirm');
 | |
|       case 'confirmEx':
 | |
|         return new Dialog(prompt, 'beforeunload');
 | |
|       default:
 | |
|         return null;
 | |
|     };
 | |
|   }
 | |
| 
 | |
|   constructor(prompt, type) {
 | |
|     this._id = helper.generateId();
 | |
|     this._type = type;
 | |
|     this._prompt = prompt;
 | |
|   }
 | |
| 
 | |
|   id() {
 | |
|     return this._id;
 | |
|   }
 | |
| 
 | |
|   message() {
 | |
|     return this._prompt.ui.infoBody.textContent;
 | |
|   }
 | |
| 
 | |
|   type() {
 | |
|     return this._type;
 | |
|   }
 | |
| 
 | |
|   prompt() {
 | |
|     return this._prompt;
 | |
|   }
 | |
| 
 | |
|   dismiss() {
 | |
|     if (this._prompt.ui.button1)
 | |
|       this._prompt.ui.button1.click();
 | |
|     else
 | |
|       this._prompt.ui.button0.click();
 | |
|   }
 | |
| 
 | |
|   defaultValue() {
 | |
|     return this._prompt.ui.loginTextbox.value;
 | |
|   }
 | |
| 
 | |
|   accept(promptValue) {
 | |
|     if (typeof promptValue === 'string' && this._type === 'prompt')
 | |
|       this._prompt.ui.loginTextbox.value = promptValue;
 | |
|     this._prompt.ui.button0.click();
 | |
|   }
 | |
| }
 | |
| 
 | |
| 
 | |
| function dirPath(path) {
 | |
|   return path.substring(0, path.lastIndexOf('/') + 1);
 | |
| }
 | |
| 
 | |
| async function waitForWindowReady(window) {
 | |
|   if (window.delayedStartupPromise) {
 | |
|     await window.delayedStartupPromise;
 | |
|   } else {
 | |
|     await new Promise((resolve => {
 | |
|       Services.obs.addObserver(function observer(aSubject, aTopic) {
 | |
|         if (window == aSubject) {
 | |
|           Services.obs.removeObserver(observer, aTopic);
 | |
|           resolve();
 | |
|         }
 | |
|       }, "browser-delayed-startup-finished");
 | |
|     }));
 | |
|   }
 | |
|   if (window.document.readyState !== 'complete')
 | |
|     await helper.awaitEvent(window, 'load');
 | |
| }
 | |
| 
 | |
| async function setViewportSizeForBrowser(viewportSize, browser, window) {
 | |
|   await waitForWindowReady(window);
 | |
|   if (viewportSize) {
 | |
|     const {width, height} = viewportSize;
 | |
|     const rect = browser.getBoundingClientRect();
 | |
|     window.resizeBy(width - rect.width, height - rect.height);
 | |
|     browser.style.setProperty('min-width', width + 'px');
 | |
|     browser.style.setProperty('min-height', height + 'px');
 | |
|     browser.style.setProperty('max-width', width + 'px');
 | |
|     browser.style.setProperty('max-height', height + 'px');
 | |
|   } else {
 | |
|     browser.style.removeProperty('min-width');
 | |
|     browser.style.removeProperty('min-height');
 | |
|     browser.style.removeProperty('max-width');
 | |
|     browser.style.removeProperty('max-height');
 | |
|   }
 | |
|   const rect = browser.getBoundingClientRect();
 | |
|   return { width: rect.width, height: rect.height };
 | |
| }
 | |
| 
 | |
| TargetRegistry.Events = {
 | |
|   TargetCreated: Symbol('TargetRegistry.Events.TargetCreated'),
 | |
|   TargetDestroyed: Symbol('TargetRegistry.Events.TargetDestroyed'),
 | |
|   DownloadCreated: Symbol('TargetRegistry.Events.DownloadCreated'),
 | |
|   DownloadFinished: Symbol('TargetRegistry.Events.DownloadFinished'),
 | |
|   ScreencastStopped: Symbol('TargetRegistry.ScreencastStopped'),
 | |
| };
 | |
| 
 | |
| var EXPORTED_SYMBOLS = ['TargetRegistry', 'PageTarget'];
 | |
| this.TargetRegistry = TargetRegistry;
 | |
| this.PageTarget = PageTarget;
 |